| MolName | (Z)-N-(1,1-dioxo-1,4-thiazinan-4-yl)-1-[2-(5-nitrofuran-2-yl)-1,3-thiazol-4-yl]methanimine |
| MolecularFormula | C12H12N4O5S2 |
| Smiles | [O-][N+](c1ccc(-c2nc(/C=N\N(CC3)CCS3(=O)=O)cs2)o1)=O |
| InChI | InChI=1S/C12H12N4O5S2/c17-16(18)11-2-1-10(21-11)12-14-9(8-22-12)7-13-15-3-5-23(19,20)6-4-15/h1-2,7-8H,3-6H2 |
| InChIK | ZSYSVYKAYJMBOF-UHFFFAOYSA-N |
| TotalMolweight | 356.382 |
| Molweight | 356.382 |
| MonoisotopicMass | 356.024911 |
| CLogP | 0.1701 |
| CLogS | -2.646 |
| H Acceptors | 9 |
| TotalSurfaceArea | 246.26 |
| Relative PSA | 0.48526 |
| PolarSurfaceArea | 158.21 |
| Druglikeness | -0.4417 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 7 |
| Symmetricatoms | 3 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-(1,1-dioxo-1,4-thiazinan-4-yl)-1-[2-(5-nitrofuran-2-yl)-1,3-thiazol-4-yl]methanimine | 2 - (Z)-N-(1,1-dioxo-1,4-thiazinan-4-yl)-1-[2-(5-nitrofuran-2-yl)-1,3-thiazol-4-yl]methanimine