| MolName | N'-[(Z)-(4-chlorophenyl)methylideneamino]-N-(2,5-dichlorophenyl)butanediamide |
| MolecularFormula | C17H14N3O2Cl3 |
| Smiles | O=C(CCC(N/N=C\c(cc1)ccc1Cl)=O)Nc(cc(cc1)Cl)c1Cl |
| InChI | InChI=1S/C17H14Cl3N3O2/c18-12-3-1-11(2-4-12)10-21-23-17(25)8-7-16(24)22-15-9-13(19)5-6-14(15)20/h1-6,9-10H,7-8H2,(H,22,24)(H,23,25) |
| InChIK | ZTFSMRSIRINBBZ-UHFFFAOYSA-N |
| TotalMolweight | 398.676 |
| Molweight | 398.676 |
| MonoisotopicMass | 397.015158 |
| CLogP | 4.8707 |
| CLogS | -6.273 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 289.98 |
| Relative PSA | 0.20867 |
| PolarSurfaceArea | 70.56 |
| Druglikeness | 3.6212 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | low |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-(4-chlorophenyl)methylideneamino]-N-(2,5-dichlorophenyl)butanediamide | 2 - N'-[(Z)-(4-chlorophenyl)methylideneamino]-N-(2,5-dichlorophenyl)butanediamide