| MolName | 2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]acetamide |
| MolecularFormula | C29H24N4O2S3 |
| Smiles | O=C(CSc1nnc(SCc2cccc3ccccc23)s1)N/N=C\c(cc1)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C29H24N4O2S3/c34-27(31-30-17-21-13-15-25(16-14-21)35-18-22-7-2-1-3-8-22)20-37-29-33-32-28(38-29)36-19-24-11-6-10-23-9-4-5-12-26(23)24/h1-17H,18-20H2,(H,31,34) |
| InChIK | ZTSRLNDVGHHSBL-UHFFFAOYSA-N |
| TotalMolweight | 556.734 |
| Molweight | 556.734 |
| MonoisotopicMass | 556.106136 |
| CLogP | 6.9555 |
| CLogS | -9.287 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 420.83 |
| Relative PSA | 0.29297 |
| PolarSurfaceArea | 155.31 |
| Druglikeness | 4.7826 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 11 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]acetamide | 2 - 2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]acetamide