| MolName | 2-[(2,4-dioxo-1H-pyrimidin-5-yl)iminomethyl]-4-nitrophenolate |
| MolecularFormula | C11H7N4O5 |
| Smiles | [O-]c(cc1)c(/C=N/C(C(N2)=O)=CNC2=O)cc1[N+]([O-])=O |
| InChI | InChI=1S/C11H8N4O5/c16-9-2-1-7(15(19)20)3-6(9)4-12-8-5-13-11(18)14-10(8)17/h1-5,16H,(H2,13,14,17,18)/p-1 |
| InChIK | ZUAHEBJNJCXRDA-UHFFFAOYSA-M |
| TotalMolweight | 275.2 |
| Molweight | 275.2 |
| MonoisotopicMass | 275.041646 |
| CLogP | -2.5351 |
| CLogS | -3.166 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 198.85 |
| Relative PSA | 0.52909 |
| PolarSurfaceArea | 139.44 |
| Druglikeness | -1.8407 |
| Mutagenic | none |
| Tumorigenic | low |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 2 |
| Amides | 2 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(2,4-dioxo-1H-pyrimidin-5-yl)iminomethyl]-4-nitrophenolate | 2 - 2-[(2,4-dioxo-1H-pyrimidin-5-yl)iminomethyl]-4-nitrophenolate