| MolName | 1-[(Z)-[2-[2-(4-nitrophenoxy)ethoxy]phenyl]methylideneamino]-3-phenylthiourea |
| MolecularFormula | C22H20N4O4S |
| Smiles | [O-][N+](c(cc1)ccc1OCCOc1c(/C=N\NC(Nc2ccccc2)=S)cccc1)=O |
| InChI | InChI=1S/C22H20N4O4S/c27-26(28)19-10-12-20(13-11-19)29-14-15-30-21-9-5-4-6-17(21)16-23-25-22(31)24-18-7-2-1-3-8-18/h1-13,16H,14-15H2,(H2,24,25,31) |
| InChIK | ZUDTWRKIOMCFPV-UHFFFAOYSA-N |
| TotalMolweight | 436.491 |
| Molweight | 436.491 |
| MonoisotopicMass | 436.120526 |
| CLogP | 4.0256 |
| CLogS | -6.049 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 344.36 |
| Relative PSA | 0.32771 |
| PolarSurfaceArea | 132.79 |
| Druglikeness | -10.181 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.67742 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-[2-[2-(4-nitrophenoxy)ethoxy]phenyl]methylideneamino]-3-phenylthiourea | 2 - 1-[(Z)-[2-[2-(4-nitrophenoxy)ethoxy]phenyl]methylideneamino]-3-phenylthiourea