| MolName | 4-chloro-2-[(Z)-[[2-(2-fluorophenoxy)acetyl]hydrazinylidene]methyl]-6-nitrophenolate |
| MolecularFormula | C15H10N3O5ClF |
| Smiles | [O-]c(c(/C=N\NC(COc(cccc1)c1F)=O)cc(Cl)c1)c1[N+]([O-])=O |
| InChI | InChI=1S/C15H11ClFN3O5/c16-10-5-9(15(22)12(6-10)20(23)24)7-18-19-14(21)8-25-13-4-2-1-3-11(13)17/h1-7,22H,8H2,(H,19,21)/p-1 |
| InChIK | ZUDYAKBLLXYGCV-UHFFFAOYSA-M |
| TotalMolweight | 366.711 |
| Molweight | 366.711 |
| MonoisotopicMass | 366.029302 |
| CLogP | 0.638 |
| CLogS | -4.715 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 263.72 |
| Relative PSA | 0.34396 |
| PolarSurfaceArea | 119.57 |
| Druglikeness | -2.2279 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-2-[(Z)-[[2-(2-fluorophenoxy)acetyl]hydrazinylidene]methyl]-6-nitrophenolate | 2 - 4-chloro-2-[(Z)-[[2-(2-fluorophenoxy)acetyl]hydrazinylidene]methyl]-6-nitrophenolate