| MolName | N-[(Z)-[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-3-fluorobenzamide |
| MolecularFormula | C25H18N2O2ClF |
| Smiles | O=C(c1cc(F)ccc1)N/N=C\c(c1ccccc1cc1)c1OCc(cccc1)c1Cl |
| InChI | InChI=1S/C25H18ClFN2O2/c26-23-11-4-2-7-19(23)16-31-24-13-12-17-6-1-3-10-21(17)22(24)15-28-29-25(30)18-8-5-9-20(27)14-18/h1-15H,16H2,(H,29,30) |
| InChIK | ZULRIKSNGJJGMG-UHFFFAOYSA-N |
| TotalMolweight | 432.881 |
| Molweight | 432.881 |
| MonoisotopicMass | 432.104083 |
| CLogP | 6.4509 |
| CLogS | -7.718 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 326.88 |
| Relative PSA | 0.14076 |
| PolarSurfaceArea | 50.69 |
| Druglikeness | 2.7114 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-3-fluorobenzamide | 2 - N-[(Z)-[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-3-fluorobenzamide