| MolName | 1-N,3-N-bis[(Z)-(2-nitrophenyl)methylideneamino]-2,4-diphenylcyclobutane-1,3-dicarboxamide |
| MolecularFormula | C32H26N6O6 |
| Smiles | [O-][N+](c1c(/C=N\NC(C(C(C2C(N/N=C\c(cccc3)c3[N+]([O-])=O)=O)c3ccccc3)C2c2ccccc2)=O)cccc1)=O |
| InChI | InChI=1S/C32H26N6O6/c39-31(35-33-19-23-15-7-9-17-25(23)37(41)42)29-27(21-11-3-1-4-12-21)30(28(29)22-13-5-2-6-14-22)32(40)36-34-20-24-16-8-10-18-26(24)38(43)44/h1-20,27-30H,(H,35,39)(H,36,40) |
| InChIK | ZUSUYJDGVWUIKJ-UHFFFAOYSA-N |
| TotalMolweight | 590.594 |
| Molweight | 590.594 |
| MonoisotopicMass | 590.191384 |
| CLogP | 5.1134 |
| CLogS | -8.45 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 444.32 |
| Relative PSA | 0.29902 |
| PolarSurfaceArea | 174.56 |
| Druglikeness | 0.21413 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.43182 |
| Fragments | 1 |
| Non HAtoms | 44 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 6 |
| Symmetricatoms | 24 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-N,3-N-bis[(Z)-(2-nitrophenyl)methylideneamino]-2,4-diphenylcyclobutane-1,3-dicarboxamide | 2 - 1-N,3-N-bis[(Z)-(2-nitrophenyl)methylideneamino]-2,4-diphenylcyclobutane-1,3-dicarboxamide