| MolName | N-[(Z)-benzylideneamino]-4-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-amine |
| MolecularFormula | C19H12N4OCl2S |
| Smiles | Clc(cc1)cc(Cl)c1-c1noc(-c2csc(N/N=C\c3ccccc3)n2)c1 |
| InChI | InChI=1S/C19H12Cl2N4OS/c20-13-6-7-14(15(21)8-13)16-9-18(26-25-16)17-11-27-19(23-17)24-22-10-12-4-2-1-3-5-12/h1-11H,(H,23,24) |
| InChIK | ZUYPIRYKLDEATL-UHFFFAOYSA-N |
| TotalMolweight | 415.303 |
| Molweight | 415.303 |
| MonoisotopicMass | 414.010885 |
| CLogP | 7.6799 |
| CLogS | -6.699 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 302.75 |
| Relative PSA | 0.2622 |
| PolarSurfaceArea | 91.55 |
| Druglikeness | 5.0546 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-benzylideneamino]-4-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-amine | 2 - N-[(Z)-benzylideneamino]-4-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-amine