| MolName | 2-[4-[(Z)-[[2-(4-chlorophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| MolecularFormula | C17H14N2O4Cl |
| Smiles | [O-]C(COc1ccc(/C=N\NC(Cc(cc2)ccc2Cl)=O)cc1)=O |
| InChI | InChI=1S/C17H15ClN2O4/c18-14-5-1-12(2-6-14)9-16(21)20-19-10-13-3-7-15(8-4-13)24-11-17(22)23/h1-8,10H,9,11H2,(H,20,21)(H,22,23)/p-1 |
| InChIK | ZVBJKMCUSBGDPX-UHFFFAOYSA-M |
| TotalMolweight | 345.761 |
| Molweight | 345.761 |
| MonoisotopicMass | 345.06421 |
| CLogP | 0.7897 |
| CLogS | -4.215 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 265.21 |
| Relative PSA | 0.2765 |
| PolarSurfaceArea | 90.82 |
| Druglikeness | 4.3131 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-[(Z)-[[2-(4-chlorophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetate | 2 - 2-[4-[(Z)-[[2-(4-chlorophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetate