| MolName | (Z)-1-(5-nitrofuran-2-yl)-N-thiomorpholin-4-ylmethanimine |
| MolecularFormula | C9H11N3O3S |
| Smiles | [O-][N+](c1ccc(/C=N\N2CCSCC2)o1)=O |
| InChI | InChI=1S/C9H11N3O3S/c13-12(14)9-2-1-8(15-9)7-10-11-3-5-16-6-4-11/h1-2,7H,3-6H2 |
| InChIK | ZVCXXSSWHIKTAW-UHFFFAOYSA-N |
| TotalMolweight | 241.27 |
| Molweight | 241.27 |
| MonoisotopicMass | 241.052112 |
| CLogP | 0.5169 |
| CLogS | -3.184 |
| H Acceptors | 6 |
| TotalSurfaceArea | 180.71 |
| Relative PSA | 0.42654 |
| PolarSurfaceArea | 99.86 |
| Druglikeness | 3.4125 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.6875 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 5 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(5-nitrofuran-2-yl)-N-thiomorpholin-4-ylmethanimine | 2 - (Z)-1-(5-nitrofuran-2-yl)-N-thiomorpholin-4-ylmethanimine