| MolName | N-(2-chlorophenyl)-2-[(2Z)-2-[(4-cyanophenyl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
| MolecularFormula | C20H14N5O4ClS |
| Smiles | N#Cc1ccc(/C=N\Nc(ccc([N+]([O-])=O)c2)c2S(Nc(cccc2)c2Cl)(=O)=O)cc1 |
| InChI | InChI=1S/C20H14ClN5O4S/c21-17-3-1-2-4-18(17)25-31(29,30)20-11-16(26(27)28)9-10-19(20)24-23-13-15-7-5-14(12-22)6-8-15/h1-11,13,24-25H |
| InChIK | ZVEFPTFEIHKDPZ-UHFFFAOYSA-N |
| TotalMolweight | 455.881 |
| Molweight | 455.881 |
| MonoisotopicMass | 455.045502 |
| CLogP | 4.66 |
| CLogS | -6.451 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 329.84 |
| Relative PSA | 0.32437 |
| PolarSurfaceArea | 148.55 |
| Druglikeness | -11.165 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 3 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-(2-chlorophenyl)-2-[(2Z)-2-[(4-cyanophenyl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide | 2 - N-(2-chlorophenyl)-2-[(2Z)-2-[(4-cyanophenyl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide