| MolName | N-[(Z)-[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2,3,4,5,6-pentafluoroaniline |
| MolecularFormula | C20H10N2OBrCl2F5 |
| Smiles | Fc(c(N/N=C\c(cc(cc1)Br)c1OCc(cc1)cc(Cl)c1Cl)c(c(F)c1F)F)c1F |
| InChI | InChI=1S/C20H10BrCl2F5N2O/c21-11-2-4-14(31-8-9-1-3-12(22)13(23)5-9)10(6-11)7-29-30-20-18(27)16(25)15(24)17(26)19(20)28/h1-7,30H,8H2 |
| InChIK | ZVEGPCCMQBRQTO-UHFFFAOYSA-N |
| TotalMolweight | 540.112 |
| Molweight | 540.112 |
| MonoisotopicMass | 537.927368 |
| CLogP | 8.6302 |
| CLogS | -8.366 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 333.98 |
| Relative PSA | 0.098718 |
| PolarSurfaceArea | 33.62 |
| Druglikeness | -1.4575 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2,3,4,5,6-pentafluoroaniline | 2 - N-[(Z)-[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2,3,4,5,6-pentafluoroaniline