| MolName | 3-[(Z)-(5-bromofuran-2-yl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| MolecularFormula | C15H12N3O2BrS |
| Smiles | O=C(c1c(N=C2)sc3c1CCCC3)N2/N=C\c(o1)ccc1Br |
| InChI | InChI=1S/C15H12BrN3O2S/c16-12-6-5-9(21-12)7-18-19-8-17-14-13(15(19)20)10-3-1-2-4-11(10)22-14/h5-8H,1-4H2 |
| InChIK | ZVFUTTWUTZPNCL-UHFFFAOYSA-N |
| TotalMolweight | 378.249 |
| Molweight | 378.249 |
| MonoisotopicMass | 376.983358 |
| CLogP | 3.6963 |
| CLogS | -5.33 |
| H Acceptors | 5 |
| TotalSurfaceArea | 242.89 |
| Relative PSA | 0.30499 |
| PolarSurfaceArea | 86.41 |
| Druglikeness | 0.063929 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.59091 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 2 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(5-bromofuran-2-yl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one | 2 - 3-[(Z)-(5-bromofuran-2-yl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one