| MolName | N-[(Z)-benzylideneamino]-2-(4-bromonaphthalen-1-yl)acetamide |
| MolecularFormula | C19H15N2OBr |
| Smiles | O=C(Cc(c1ccccc11)ccc1Br)N/N=C\c1ccccc1 |
| InChI | InChI=1S/C19H15BrN2O/c20-18-11-10-15(16-8-4-5-9-17(16)18)12-19(23)22-21-13-14-6-2-1-3-7-14/h1-11,13H,12H2,(H,22,23) |
| InChIK | ZVZZRYDNXAMYGQ-UHFFFAOYSA-N |
| TotalMolweight | 367.245 |
| Molweight | 367.245 |
| MonoisotopicMass | 366.036774 |
| CLogP | 5.1193 |
| CLogS | -6.126 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 253.98 |
| Relative PSA | 0.14178 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 2.5805 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6087 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-benzylideneamino]-2-(4-bromonaphthalen-1-yl)acetamide | 2 - N-[(Z)-benzylideneamino]-2-(4-bromonaphthalen-1-yl)acetamide