| MolName | 2,4-dichloro-N-[(Z)-[5-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]methylideneamino]benzamide |
| MolecularFormula | C26H17N5O2Cl2S |
| Smiles | O=C(c(ccc(Cl)c1)c1Cl)N/N=C\c(o1)ccc1Sc1nnc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C26H17Cl2N5O2S/c27-18-11-13-21(22(28)15-18)25(34)31-29-16-20-12-14-23(35-20)36-26-32-30-24(17-7-3-1-4-8-17)33(26)19-9-5-2-6-10-19/h1-16H,(H,31,34) |
| InChIK | ZWFJIWOKGMKLEV-UHFFFAOYSA-N |
| TotalMolweight | 534.426 |
| Molweight | 534.426 |
| MonoisotopicMass | 533.047999 |
| CLogP | 6.6382 |
| CLogS | -10.577 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 391.01 |
| Relative PSA | 0.24659 |
| PolarSurfaceArea | 110.61 |
| Druglikeness | 7.2918 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2,4-dichloro-N-[(Z)-[5-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]methylideneamino]benzamide | 2 - 2,4-dichloro-N-[(Z)-[5-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]methylideneamino]benzamide