| MolName | (E)-3-phenyl-N-[4-[4-[[(E)-3-phenylprop-2-enylidene]amino]phenyl]sulfonylphenyl]prop-2-en-1-imine |
| MolecularFormula | C30H24N2O2S |
| Smiles | O=S(c(cc1)ccc1/N=C/C=C/c1ccccc1)(c(cc1)ccc1/N=C/C=C/c1ccccc1)=O |
| InChI | InChI=1S/C30H24N2O2S/c33-35(34,29-19-15-27(16-20-29)31-23-7-13-25-9-3-1-4-10-25)30-21-17-28(18-22-30)32-24-8-14-26-11-5-2-6-12-26/h1-24H |
| InChIK | ZWGKBUDLJLCNEH-UHFFFAOYSA-N |
| TotalMolweight | 476.599 |
| Molweight | 476.599 |
| MonoisotopicMass | 476.155848 |
| CLogP | 5.149 |
| CLogS | -6.82 |
| H Acceptors | 4 |
| TotalSurfaceArea | 383.64 |
| Relative PSA | 0.1345 |
| PolarSurfaceArea | 67.24 |
| Druglikeness | -2.3655 |
| Mutagenic | none |
| Tumorigenic | low |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 1 |
| Symmetricatoms | 21 |
| StereoCon |
Click to Load Molecule:
1 - (E)-3-phenyl-N-[4-[4-[[(E)-3-phenylprop-2-enylidene]amino]phenyl]sulfonylphenyl]prop-2-en-1-imine | 2 - (E)-3-phenyl-N-[4-[4-[[(E)-3-phenylprop-2-enylidene]amino]phenyl]sulfonylphenyl]prop-2-en-1-imine