| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-anthracen-9-ylmethylideneamino]-5-(piperidin-1-ium-1-ylmethyl)triazole-4-carboxamide |
| MolecularFormula | C26H26N9O2 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2c(cccc3)c3cc3ccccc23)=O)c1C[NH+]1CCCCC1 |
| InChI | InChI=1S/C26H25N9O2/c27-24-25(32-37-31-24)35-22(16-34-12-6-1-7-13-34)23(29-33-35)26(36)30-28-15-21-19-10-4-2-8-17(19)14-18-9-3-5-11-20(18)21/h2-5,8-11,14-15H,1,6-7,12-13,16H2,(H2,27,31)(H,30,36)/p+1 |
| InChIK | ZWHGHNBUKYLNFP-UHFFFAOYSA-O |
| TotalMolweight | 496.553 |
| Molweight | 496.553 |
| MonoisotopicMass | 496.220946 |
| CLogP | 2.7844 |
| CLogS | -5.134 |
| H Acceptors | 11 |
| H Donors | 3 |
| TotalSurfaceArea | 391.8 |
| Relative PSA | 0.34132 |
| PolarSurfaceArea | 141.55 |
| Druglikeness | -1.2815 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.43243 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 7 |
| Symmetricatoms | 8 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 5 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-anthracen-9-ylmethylideneamino]-5-(piperidin-1-ium-1-ylmethyl)triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-anthracen-9-ylmethylideneamino]-5-(piperidin-1-ium-1-ylmethyl)triazole-4-carboxamide