| MolName | 3,5-dibromo-N-[(Z)-[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-2-hydroxybenzamide |
| MolecularFormula | C30H20N3O2Br3 |
| Smiles | Oc(c(C(N/N=C\c(cc1-c2ccccc2)c(-c2ccccc2)n1-c(cc1)ccc1Br)=O)cc(Br)c1)c1Br |
| InChI | InChI=1S/C30H20Br3N3O2/c31-22-11-13-24(14-12-22)36-27(19-7-3-1-4-8-19)15-21(28(36)20-9-5-2-6-10-20)18-34-35-30(38)25-16-23(32)17-26(33)29(25)37/h1-18,37H,(H,35,38) |
| InChIK | ZWUWISYQELMCGU-UHFFFAOYSA-N |
| TotalMolweight | 694.22 |
| Molweight | 694.22 |
| MonoisotopicMass | 690.91056 |
| CLogP | 8.7168 |
| CLogS | -11.796 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 417.71 |
| Relative PSA | 0.13402 |
| PolarSurfaceArea | 66.62 |
| Druglikeness | 3.767 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.42105 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 29 |
| Sp3Atoms | 1 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3,5-dibromo-N-[(Z)-[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-2-hydroxybenzamide | 2 - 3,5-dibromo-N-[(Z)-[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-2-hydroxybenzamide