| MolName | N'-[(Z)-(2-fluorophenyl)methylideneamino]pyridine-2-carboximidamide |
| MolecularFormula | C13H11N4F |
| Smiles | N/C(/c1ncccc1)=N/N=C\c(cccc1)c1F |
| InChI | InChI=1S/C13H11FN4/c14-11-6-2-1-5-10(11)9-17-18-13(15)12-7-3-4-8-16-12/h1-9H,(H2,15,18) |
| InChIK | ZWYBOKCXLKJDSA-UHFFFAOYSA-N |
| TotalMolweight | 242.256 |
| Molweight | 242.256 |
| MonoisotopicMass | 242.096774 |
| CLogP | 3.0935 |
| CLogS | -3.44 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 194.38 |
| Relative PSA | 0.25342 |
| PolarSurfaceArea | 63.63 |
| Druglikeness | 0.14605 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-(2-fluorophenyl)methylideneamino]pyridine-2-carboximidamide | 2 - N'-[(Z)-(2-fluorophenyl)methylideneamino]pyridine-2-carboximidamide