| MolName | N,N'-bis[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]oxamide |
| MolecularFormula | C24H28N6O2Cl4 |
| Smiles | O=C(C(N/N=C\c(cc1)ccc1N(CCCl)CCCl)=O)N/N=C\c(cc1)ccc1N(CCCl)CCCl |
| InChI | InChI=1S/C24H28Cl4N6O2/c25-9-13-33(14-10-26)21-5-1-19(2-6-21)17-29-31-23(35)24(36)32-30-18-20-3-7-22(8-4-20)34(15-11-27)16-12-28/h1-8,17-18H,9-16H2,(H,31,35)(H,32,36) |
| InChIK | ZWYLGLKQKLIMGY-UHFFFAOYSA-N |
| TotalMolweight | 574.338 |
| Molweight | 574.338 |
| MonoisotopicMass | 572.102782 |
| CLogP | 4.8736 |
| CLogS | -6.994 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 433.32 |
| Relative PSA | 0.18259 |
| PolarSurfaceArea | 89.4 |
| Druglikeness | 6.0985 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 15 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 23 |
| Amines | 2 |
| Aromatic Amines | 2 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]oxamide | 2 - N,N'-bis[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]oxamide