| MolName | 4-benzamido-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]benzamide |
| MolecularFormula | C28H23N3O3 |
| Smiles | O=C(c1ccccc1)Nc(cc1)ccc1C(N/N=C\c(cccc1)c1OCc1ccccc1)=O |
| InChI | InChI=1S/C28H23N3O3/c32-27(22-11-5-2-6-12-22)30-25-17-15-23(16-18-25)28(33)31-29-19-24-13-7-8-14-26(24)34-20-21-9-3-1-4-10-21/h1-19H,20H2,(H,30,32)(H,31,33) |
| InChIK | ZXICIECVPOADMU-UHFFFAOYSA-N |
| TotalMolweight | 449.509 |
| Molweight | 449.509 |
| MonoisotopicMass | 449.173942 |
| CLogP | 5.6972 |
| CLogS | -6.574 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 359.48 |
| Relative PSA | 0.19614 |
| PolarSurfaceArea | 79.79 |
| Druglikeness | 4.498 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-benzamido-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]benzamide | 2 - 4-benzamido-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]benzamide