| MolName | 2,2-bis(4-chlorophenyl)-2-hydroxy-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide |
| MolecularFormula | C19H14N2O2Cl2S |
| Smiles | OC(C(N/N=C\c1cccs1)=O)(c(cc1)ccc1Cl)c(cc1)ccc1Cl |
| InChI | InChI=1S/C19H14Cl2N2O2S/c20-15-7-3-13(4-8-15)19(25,14-5-9-16(21)10-6-14)18(24)23-22-12-17-2-1-11-26-17/h1-12,25H,(H,23,24) |
| InChIK | ZXOSQTKRABACRB-UHFFFAOYSA-N |
| TotalMolweight | 405.304 |
| Molweight | 405.304 |
| MonoisotopicMass | 404.015302 |
| CLogP | 4.5605 |
| CLogS | -5.909 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 290.29 |
| Relative PSA | 0.23931 |
| PolarSurfaceArea | 89.93 |
| Druglikeness | 6.9706 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 9 |
| StereoCon |
Click to Load Molecule:
1 - 2,2-bis(4-chlorophenyl)-2-hydroxy-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide | 2 - 2,2-bis(4-chlorophenyl)-2-hydroxy-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide