| MolName | [2-methoxy-4-[(Z)-[[2-[(3-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate |
| MolecularFormula | C27H27N3O6 |
| Smiles | CCOc(cc1)ccc1C(Oc(ccc(/C=N\NC(CNC(c1cc(C)ccc1)=O)=O)c1)c1OC)=O |
| InChI | InChI=1S/C27H27N3O6/c1-4-35-22-11-9-20(10-12-22)27(33)36-23-13-8-19(15-24(23)34-3)16-29-30-25(31)17-28-26(32)21-7-5-6-18(2)14-21/h5-16H,4,17H2,1-3H3,(H,28,32)(H,30,31) |
| InChIK | ZXQRREVQPPRSTF-UHFFFAOYSA-N |
| TotalMolweight | 489.526 |
| Molweight | 489.526 |
| MonoisotopicMass | 489.189987 |
| CLogP | 4.326 |
| CLogS | -5.638 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 388.01 |
| Relative PSA | 0.26687 |
| PolarSurfaceArea | 115.32 |
| Druglikeness | 3.7246 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 11 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 8 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2-methoxy-4-[(Z)-[[2-[(3-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate | 2 - [2-methoxy-4-[(Z)-[[2-[(3-methylbenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate