| MolName | 2-[[4-(4-methoxyphenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(naphthalen-1-ylmethylideneamino)acetamide |
| MolecularFormula | C29H25N5O2S |
| Smiles | Cc(cc1)ccc1-c(n1-c(cc2)ccc2OC)nnc1SCC(NN=Cc1cccc2ccccc12)=O |
| InChI | InChI=1S/C29H25N5O2S/c1-20-10-12-22(13-11-20)28-32-33-29(34(28)24-14-16-25(36-2)17-15-24)37-19-27(35)31-30-18-23-8-5-7-21-6-3-4-9-26(21)23/h3-18H,19H2,1-2H3,(H,31,35) |
| InChIK | AWFCRCFQISETAO-UHFFFAOYSA-N |
| TotalMolweight | 507.617 |
| Molweight | 507.617 |
| MonoisotopicMass | 507.172895 |
| CLogP | 6.0001 |
| CLogS | -10.384 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 393.6 |
| Relative PSA | 0.23453 |
| PolarSurfaceArea | 106.7 |
| Druglikeness | 5.317 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51351 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[4-(4-methoxyphenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(naphthalen-1-ylmethylideneamino)acetamide | 2 - 2-[[4-(4-methoxyphenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(naphthalen-1-ylmethylideneamino)acetamide