| MolName | 3-N-[(Z)-(2,4-dichloro-5-nitrophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine |
| MolecularFormula | C9H7N7O2Cl2 |
| Smiles | Nn1c(N/N=C\c(c(Cl)c2)cc([N+]([O-])=O)c2Cl)nnc1 |
| InChI | InChI=1S/C9H7Cl2N7O2/c10-6-2-7(11)8(18(19)20)1-5(6)3-13-15-9-16-14-4-17(9)12/h1-4H,12H2,(H,15,16) |
| InChIK | BVAASXBABQMVSH-UHFFFAOYSA-N |
| TotalMolweight | 316.108 |
| Molweight | 316.108 |
| MonoisotopicMass | 315.003827 |
| CLogP | 3.3897 |
| CLogS | -6.686 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 218.99 |
| Relative PSA | 0.44509 |
| PolarSurfaceArea | 126.94 |
| Druglikeness | -3.186 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.55 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-N-[(Z)-(2,4-dichloro-5-nitrophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine | 2 - 3-N-[(Z)-(2,4-dichloro-5-nitrophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine