| MolName | 4-amino-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| MolecularFormula | C8H6N6O5 |
| Smiles | Nc1nonc1C(N/N=C\c1ccc([N+]([O-])=O)o1)=O |
| InChI | InChI=1S/C8H6N6O5/c9-7-6(12-19-13-7)8(15)11-10-3-4-1-2-5(18-4)14(16)17/h1-3H,(H2,9,13)(H,11,15) |
| InChIK | BZEPJPZUELCMEC-UHFFFAOYSA-N |
| TotalMolweight | 266.173 |
| Molweight | 266.173 |
| MonoisotopicMass | 266.039969 |
| CLogP | 0.0595 |
| CLogS | -3.256 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 196.08 |
| Relative PSA | 0.67248 |
| PolarSurfaceArea | 165.36 |
| Druglikeness | 4.6323 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63158 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide | 2 - 4-amino-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide