| MolName | N,N'-bis[(Z)-(5-nitrofuran-2-yl)methylideneamino]pentanediamide |
| MolecularFormula | C15H14N6O8 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(CCCC(N/N=C\c2ccc([N+]([O-])=O)o2)=O)=O)o1)=O |
| InChI | InChI=1S/C15H14N6O8/c22-12(18-16-8-10-4-6-14(28-10)20(24)25)2-1-3-13(23)19-17-9-11-5-7-15(29-11)21(26)27/h4-9H,1-3H2,(H,18,22)(H,19,23) |
| InChIK | COBZZKIKRBOGJE-UHFFFAOYSA-N |
| TotalMolweight | 406.31 |
| Molweight | 406.31 |
| MonoisotopicMass | 406.087314 |
| CLogP | 1.1386 |
| CLogS | -6.262 |
| H Acceptors | 14 |
| H Donors | 2 |
| TotalSurfaceArea | 308.96 |
| Relative PSA | 0.52136 |
| PolarSurfaceArea | 200.84 |
| Druglikeness | -2.5119 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72414 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 10 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 5 |
| Symmetricatoms | 14 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-(5-nitrofuran-2-yl)methylideneamino]pentanediamide | 2 - N,N'-bis[(Z)-(5-nitrofuran-2-yl)methylideneamino]pentanediamide