| MolName | 4-amino-N'-[(3-prop-2-ynoxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
| MolecularFormula | C13H12N6O2 |
| Smiles | C#CCOc1cccc(C=N/N=C(\c2nonc2N)/N)c1 |
| InChI | InChI=1S/C13H12N6O2/c1-2-6-20-10-5-3-4-9(7-10)8-16-17-12(14)11-13(15)19-21-18-11/h1,3-5,7-8H,6H2,(H2,14,17)(H2,15,19) |
| InChIK | FINTURMMPYNOFT-UHFFFAOYSA-N |
| TotalMolweight | 284.278 |
| Molweight | 284.278 |
| MonoisotopicMass | 284.102174 |
| CLogP | 2.1362 |
| CLogS | -3.407 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 232.57 |
| Relative PSA | 0.4283 |
| PolarSurfaceArea | 124.91 |
| Druglikeness | 2.1621 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N'-[(3-prop-2-ynoxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide | 2 - 4-amino-N'-[(3-prop-2-ynoxyphenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide