| MolName | N-[(Z)-[5-(4-sulfamoylphenyl)furan-2-yl]methylideneamino]pyridine-4-carboxamide |
| MolecularFormula | C17H14N4O4S |
| Smiles | NS(c(cc1)ccc1-c1ccc(/C=N\NC(c2ccncc2)=O)o1)(=O)=O |
| InChI | InChI=1S/C17H14N4O4S/c18-26(23,24)15-4-1-12(2-5-15)16-6-3-14(25-16)11-20-21-17(22)13-7-9-19-10-8-13/h1-11H,(H,21,22)(H2,18,23,24) |
| InChIK | FMMDYAVGXHBOHG-UHFFFAOYSA-N |
| TotalMolweight | 370.388 |
| Molweight | 370.388 |
| MonoisotopicMass | 370.073576 |
| CLogP | 1.9036 |
| CLogS | -4.285 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 272.3 |
| Relative PSA | 0.38538 |
| PolarSurfaceArea | 136.03 |
| Druglikeness | 9.0145 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 5 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(4-sulfamoylphenyl)furan-2-yl]methylideneamino]pyridine-4-carboxamide | 2 - N-[(Z)-[5-(4-sulfamoylphenyl)furan-2-yl]methylideneamino]pyridine-4-carboxamide