| MolName | N-[(Z)-(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-2,3,4,5,6-pentafluoroaniline |
| MolecularFormula | C16H8N2OBrF5 |
| Smiles | C#CCOc(cc1)c(/C=N\Nc(c(F)c(c(F)c2F)F)c2F)cc1Br |
| InChI | InChI=1S/C16H8BrF5N2O/c1-2-5-25-10-4-3-9(17)6-8(10)7-23-24-16-14(21)12(19)11(18)13(20)15(16)22/h1,3-4,6-7,24H,5H2 |
| InChIK | FRFPTPOGRHDVCP-UHFFFAOYSA-N |
| TotalMolweight | 419.147 |
| Molweight | 419.147 |
| MonoisotopicMass | 417.974014 |
| CLogP | 6.0273 |
| CLogS | -6.195 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 267.19 |
| Relative PSA | 0.1234 |
| PolarSurfaceArea | 33.62 |
| Druglikeness | -1.4725 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.56 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-2,3,4,5,6-pentafluoroaniline | 2 - N-[(Z)-(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-2,3,4,5,6-pentafluoroaniline