| MolName | 5-[(3,5-dimethoxyphenyl)methyliminomethyl]-1-(3,5-dimethylphenyl)-6-hydroxypyrimidine-2,4-dione |
| MolecularFormula | C22H23N3O5 |
| Smiles | Cc1cc(N(C(O)=C(/C=N/Cc2cc(OC)cc(OC)c2)C(N2)=O)C2=O)cc(C)c1 |
| InChI | InChI=1S/C22H23N3O5/c1-13-5-14(2)7-16(6-13)25-21(27)19(20(26)24-22(25)28)12-23-11-15-8-17(29-3)10-18(9-15)30-4/h5-10,12,27H,11H2,1-4H3,(H,24,26,28) |
| InChIK | GFNKBCDXAYGNMF-UHFFFAOYSA-N |
| TotalMolweight | 409.441 |
| Molweight | 409.441 |
| MonoisotopicMass | 409.163772 |
| CLogP | 2.2905 |
| CLogS | -5.661 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 313.61 |
| Relative PSA | 0.27327 |
| PolarSurfaceArea | 100.46 |
| Druglikeness | 5.499 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | polar activated DB; twice activated DB; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 7 |
| Amides | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-[(3,5-dimethoxyphenyl)methyliminomethyl]-1-(3,5-dimethylphenyl)-6-hydroxypyrimidine-2,4-dione | 2 - 5-[(3,5-dimethoxyphenyl)methyliminomethyl]-1-(3,5-dimethylphenyl)-6-hydroxypyrimidine-2,4-dione