| MolName | N-[(Z)-2-(1,3-benzodioxol-5-yl)ethylideneamino]-1,4,5,6-tetrahydropyrimidin-2-amine |
| MolecularFormula | C13H16N4O2 |
| Smiles | C(/C=N\NC1=NCCCN1)c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C13H16N4O2/c1-5-14-13(15-6-1)17-16-7-4-10-2-3-11-12(8-10)19-9-18-11/h2-3,7-8H,1,4-6,9H2,(H2,14,15,17) |
| InChIK | HBCPONUTWFCOKU-UHFFFAOYSA-N |
| TotalMolweight | 260.296 |
| Molweight | 260.296 |
| MonoisotopicMass | 260.127326 |
| CLogP | 1.5544 |
| CLogS | -3.8 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 205.71 |
| Relative PSA | 0.32055 |
| PolarSurfaceArea | 67.24 |
| Druglikeness | 4.0541 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 7 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-2-(1,3-benzodioxol-5-yl)ethylideneamino]-1,4,5,6-tetrahydropyrimidin-2-amine | 2 - N-[(Z)-2-(1,3-benzodioxol-5-yl)ethylideneamino]-1,4,5,6-tetrahydropyrimidin-2-amine