| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-3-[(E)-(5-nitrofuran-2-yl)methylideneamino]urea |
| MolecularFormula | C8H7N7O5 |
| Smiles | Nc1nonc1NC(N/N=C/c1ccc([N+]([O-])=O)o1)=O |
| InChI | InChI=1S/C8H7N7O5/c9-6-7(14-20-13-6)11-8(16)12-10-3-4-1-2-5(19-4)15(17)18/h1-3H,(H2,9,13)(H2,11,12,14,16) |
| InChIK | HEWWUYIXFPACSF-UHFFFAOYSA-N |
| TotalMolweight | 281.188 |
| Molweight | 281.188 |
| MonoisotopicMass | 281.050868 |
| CLogP | 0.3508 |
| CLogS | -4.273 |
| H Acceptors | 12 |
| H Donors | 3 |
| TotalSurfaceArea | 207.54 |
| Relative PSA | 0.69057 |
| PolarSurfaceArea | 177.39 |
| Druglikeness | 3.4836 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.65 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 1 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-3-[(E)-(5-nitrofuran-2-yl)methylideneamino]urea | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-3-[(E)-(5-nitrofuran-2-yl)methylideneamino]urea