| MolName | N,N'-bis[(Z)-(5-bromofuran-2-yl)methylideneamino]decanediamide |
| MolecularFormula | C20H24N4O4Br2 |
| Smiles | O=C(CCCCCCCCC(N/N=C\c(o1)ccc1Br)=O)N/N=C\c(o1)ccc1Br |
| InChI | InChI=1S/C20H24Br2N4O4/c21-17-11-9-15(29-17)13-23-25-19(27)7-5-3-1-2-4-6-8-20(28)26-24-14-16-10-12-18(22)30-16/h9-14H,1-8H2,(H,25,27)(H,26,28) |
| InChIK | JVERNGDKMVVHIG-UHFFFAOYSA-N |
| TotalMolweight | 544.243 |
| Molweight | 544.243 |
| MonoisotopicMass | 542.016428 |
| CLogP | 6.1962 |
| CLogS | -6.836 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 367.68 |
| Relative PSA | 0.27263 |
| PolarSurfaceArea | 109.2 |
| Druglikeness | -5.3033 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.8 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 13 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 8 |
| Symmetricatoms | 15 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-(5-bromofuran-2-yl)methylideneamino]decanediamide | 2 - N,N'-bis[(Z)-(5-bromofuran-2-yl)methylideneamino]decanediamide