| MolName | 3-[[5-[[(3-bromobenzoyl)hydrazinylidene]methyl]-4-chloro-2-oxo-1,3-thiazol-3-yl]methyl]benzoic acid |
| MolecularFormula | C19H13N3O4BrClS |
| Smiles | OC(c1cccc(CN(C(Cl)=C(C=NNC(c2cccc(Br)c2)=O)S2)C2=O)c1)=O |
| InChI | InChI=1S/C19H13BrClN3O4S/c20-14-6-2-4-12(8-14)17(25)23-22-9-15-16(21)24(19(28)29-15)10-11-3-1-5-13(7-11)18(26)27/h1-9H,10H2,(H,23,25)(H,26,27) |
| InChIK | LFMAWGNNQXZKAW-UHFFFAOYSA-N |
| TotalMolweight | 494.752 |
| Molweight | 494.752 |
| MonoisotopicMass | 492.949865 |
| CLogP | 3.7822 |
| CLogS | -6.175 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 313.86 |
| Relative PSA | 0.3066 |
| PolarSurfaceArea | 124.37 |
| Druglikeness | 5.4704 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | polar activated DB; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58621 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[[5-[[(3-bromobenzoyl)hydrazinylidene]methyl]-4-chloro-2-oxo-1,3-thiazol-3-yl]methyl]benzoic acid | 2 - 3-[[5-[[(3-bromobenzoyl)hydrazinylidene]methyl]-4-chloro-2-oxo-1,3-thiazol-3-yl]methyl]benzoic acid