| MolName | 8-methoxy-3-(quinolin-2-ylmethylideneamino)-5H-pyrimido[5,4-b]indol-4-one |
| MolecularFormula | C21H15N5O2 |
| Smiles | COc(cc1)cc2c1[nH]c(C1=O)c2N=CN1N=Cc1nc2ccccc2cc1 |
| InChI | InChI=1S/C21H15N5O2/c1-28-15-8-9-18-16(10-15)19-20(25-18)21(27)26(12-22-19)23-11-14-7-6-13-4-2-3-5-17(13)24-14/h2-12,25H,1H3 |
| InChIK | LJBMKPRASZTLJI-UHFFFAOYSA-N |
| TotalMolweight | 369.383 |
| Molweight | 369.383 |
| MonoisotopicMass | 369.122575 |
| CLogP | 2.8654 |
| CLogS | -5.096 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 276.88 |
| Relative PSA | 0.26932 |
| PolarSurfaceArea | 82.94 |
| Druglikeness | 5.2028 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 8-methoxy-3-(quinolin-2-ylmethylideneamino)-5H-pyrimido[5,4-b]indol-4-one | 2 - 8-methoxy-3-(quinolin-2-ylmethylideneamino)-5H-pyrimido[5,4-b]indol-4-one