| MolName | (E,4Z)-2,3-dichloro-4-[(3,5-dichlorophenyl)hydrazinylidene]but-2-enoic acid |
| MolecularFormula | C10H6N2O2Cl4 |
| Smiles | OC(/C(/Cl)=C(/C=N\Nc1cc(Cl)cc(Cl)c1)\Cl)=O |
| InChI | InChI=1S/C10H6Cl4N2O2/c11-5-1-6(12)3-7(2-5)16-15-4-8(13)9(14)10(17)18/h1-4,16H,(H,17,18) |
| InChIK | NQHDYNUNPHEATI-UHFFFAOYSA-N |
| TotalMolweight | 327.982 |
| Molweight | 327.982 |
| MonoisotopicMass | 325.918336 |
| CLogP | 4.6017 |
| CLogS | -4.542 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 218.18 |
| Relative PSA | 0.22509 |
| PolarSurfaceArea | 61.69 |
| Druglikeness | -0.2955 |
| Mutagenic | high |
| Tumorigenic | low |
| Reproductive Effective | high |
| Irritant | low |
| Nasty Functions | 1,2-dihalo-alkene; imine/hydrazone of aldehyde; 2-halo-enone; 3-halo-enone |
| Shape Index | 0.61111 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 1 |
| Symmetricatoms | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (E,4Z)-2,3-dichloro-4-[(3,5-dichlorophenyl)hydrazinylidene]but-2-enoic acid | 2 - (E,4Z)-2,3-dichloro-4-[(3,5-dichlorophenyl)hydrazinylidene]but-2-enoic acid