| MolName | N,N'-bis[(Z)-(5-bromofuran-2-yl)methylideneamino]nonanediamide |
| MolecularFormula | C19H22N4O4Br2 |
| Smiles | O=C(CCCCCCCC(N/N=C\c(o1)ccc1Br)=O)N/N=C\c(o1)ccc1Br |
| InChI | InChI=1S/C19H22Br2N4O4/c20-16-10-8-14(28-16)12-22-24-18(26)6-4-2-1-3-5-7-19(27)25-23-13-15-9-11-17(21)29-15/h8-13H,1-7H2,(H,24,26)(H,25,27) |
| InChIK | OCYISRXBTMDOJM-UHFFFAOYSA-N |
| TotalMolweight | 530.216 |
| Molweight | 530.216 |
| MonoisotopicMass | 528.000778 |
| CLogP | 5.7418 |
| CLogS | -6.566 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 353.92 |
| Relative PSA | 0.28323 |
| PolarSurfaceArea | 109.2 |
| Druglikeness | -5.3033 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7931 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 12 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 7 |
| Symmetricatoms | 14 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-(5-bromofuran-2-yl)methylideneamino]nonanediamide | 2 - N,N'-bis[(Z)-(5-bromofuran-2-yl)methylideneamino]nonanediamide