| MolName | 2-hydroxy-3,5-dinitro-N-[(Z)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]benzamide |
| MolecularFormula | C14H9N5O9 |
| Smiles | [O-][N+](c1ccc(/C=C/C=N\NC(c2cc([N+]([O-])=O)cc([N+]([O-])=O)c2O)=O)o1)=O |
| InChI | InChI=1S/C14H9N5O9/c20-13-10(6-8(17(22)23)7-11(13)18(24)25)14(21)16-15-5-1-2-9-3-4-12(28-9)19(26)27/h1-7,20H,(H,16,21) |
| InChIK | OKARQUYKPASIMF-UHFFFAOYSA-N |
| TotalMolweight | 391.251 |
| Molweight | 391.251 |
| MonoisotopicMass | 391.04003 |
| CLogP | -0.3505 |
| CLogS | -5.304 |
| H Acceptors | 14 |
| H Donors | 2 |
| TotalSurfaceArea | 280.54 |
| Relative PSA | 0.55065 |
| PolarSurfaceArea | 212.29 |
| Druglikeness | 1.1143 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 4 |
| AcidicOxygens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-hydroxy-3,5-dinitro-N-[(Z)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]benzamide | 2 - 2-hydroxy-3,5-dinitro-N-[(Z)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]benzamide