| MolName | 2-hydroxy-N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide |
| MolecularFormula | C20H21N3O5 |
| Smiles | Oc(cccc1)c1C(N/N=C\c(cc1)ccc1OCC(N1CCOCC1)=O)=O |
| InChI | InChI=1S/C20H21N3O5/c24-18-4-2-1-3-17(18)20(26)22-21-13-15-5-7-16(8-6-15)28-14-19(25)23-9-11-27-12-10-23/h1-8,13,24H,9-12,14H2,(H,22,26) |
| InChIK | PMISACJZGVZVNU-UHFFFAOYSA-N |
| TotalMolweight | 383.403 |
| Molweight | 383.403 |
| MonoisotopicMass | 383.148122 |
| CLogP | 2.1051 |
| CLogS | -2.915 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 296.69 |
| Relative PSA | 0.28885 |
| PolarSurfaceArea | 100.46 |
| Druglikeness | 6.0203 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-hydroxy-N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide | 2 - 2-hydroxy-N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide