| MolName | 2-[[4-ethyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(5-methylthiophen-2-yl)methylideneamino]acetamide |
| MolecularFormula | C19H21N5O2S2 |
| Smiles | CCn1c(SCC(NN=Cc2ccc(C)s2)=O)nnc1-c(cc1)ccc1OC |
| InChI | InChI=1S/C19H21N5O2S2/c1-4-24-18(14-6-8-15(26-3)9-7-14)22-23-19(24)27-12-17(25)21-20-11-16-10-5-13(2)28-16/h5-11H,4,12H2,1-3H3,(H,21,25) |
| InChIK | POAPYLOPHFJVSE-UHFFFAOYSA-N |
| TotalMolweight | 415.541 |
| Molweight | 415.541 |
| MonoisotopicMass | 415.113665 |
| CLogP | 3.6809 |
| CLogS | -5.277 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 321.2 |
| Relative PSA | 0.35078 |
| PolarSurfaceArea | 134.94 |
| Druglikeness | 7.2536 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[4-ethyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(5-methylthiophen-2-yl)methylideneamino]acetamide | 2 - 2-[[4-ethyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(5-methylthiophen-2-yl)methylideneamino]acetamide