| MolName | N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzenesulfonamide |
| MolecularFormula | C19H21N3O5S |
| Smiles | O=C(COc1ccc(/C=N\NS(c2ccccc2)(=O)=O)cc1)N1CCOCC1 |
| InChI | InChI=1S/C19H21N3O5S/c23-19(22-10-12-26-13-11-22)15-27-17-8-6-16(7-9-17)14-20-21-28(24,25)18-4-2-1-3-5-18/h1-9,14,21H,10-13,15H2 |
| InChIK | QTPGTHZCSMKXHU-UHFFFAOYSA-N |
| TotalMolweight | 403.458 |
| Molweight | 403.458 |
| MonoisotopicMass | 403.120192 |
| CLogP | 1.5263 |
| CLogS | -1.406 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 301.17 |
| Relative PSA | 0.29266 |
| PolarSurfaceArea | 105.68 |
| Druglikeness | -1.395 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 7 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzenesulfonamide | 2 - N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzenesulfonamide