| MolName | 3-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,2,5-oxadiazole-3,4-diamine |
| MolecularFormula | C7H6N6O4 |
| Smiles | Nc1nonc1N/N=C\c1ccc([N+]([O-])=O)o1 |
| InChI | InChI=1S/C7H6N6O4/c8-6-7(12-17-11-6)10-9-3-4-1-2-5(16-4)13(14)15/h1-3H,(H2,8,11)(H,10,12) |
| InChIK | RVVOCLGKOWCXCR-UHFFFAOYSA-N |
| TotalMolweight | 238.163 |
| Molweight | 238.163 |
| MonoisotopicMass | 238.045054 |
| CLogP | 1.9962 |
| CLogS | -3.185 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 178.33 |
| Relative PSA | 0.66629 |
| PolarSurfaceArea | 148.29 |
| Druglikeness | 1.7852 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,2,5-oxadiazole-3,4-diamine | 2 - 3-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,2,5-oxadiazole-3,4-diamine