| MolName | 2-hydroxy-N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2,2-diphenylacetamide |
| MolecularFormula | C27H27N3O5 |
| Smiles | OC(C(N/N=C\c(cc1)ccc1OCC(N1CCOCC1)=O)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H27N3O5/c31-25(30-15-17-34-18-16-30)20-35-24-13-11-21(12-14-24)19-28-29-26(32)27(33,22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-14,19,33H,15-18,20H2,(H,29,32) |
| InChIK | SJEIROASLSHKRV-UHFFFAOYSA-N |
| TotalMolweight | 473.527 |
| Molweight | 473.527 |
| MonoisotopicMass | 473.195072 |
| CLogP | 2.7311 |
| CLogS | -3.917 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 366.86 |
| Relative PSA | 0.2336 |
| PolarSurfaceArea | 100.46 |
| Druglikeness | 6.912 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 9 |
| Symmetricatoms | 12 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-hydroxy-N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2,2-diphenylacetamide | 2 - 2-hydroxy-N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2,2-diphenylacetamide