| MolName | 4-amino-N-[(E)-(2,4-dichloro-5-nitrophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| MolecularFormula | C10H6N6O4Cl2 |
| Smiles | Nc1nonc1C(N/N=C/c(c(Cl)c1)cc([N+]([O-])=O)c1Cl)=O |
| InChI | InChI=1S/C10H6Cl2N6O4/c11-5-2-6(12)7(18(20)21)1-4(5)3-14-15-10(19)8-9(13)17-22-16-8/h1-3H,(H2,13,17)(H,15,19) |
| InChIK | UYCCUBBNTMSJPC-UHFFFAOYSA-N |
| TotalMolweight | 345.102 |
| Molweight | 345.102 |
| MonoisotopicMass | 343.982758 |
| CLogP | 1.7314 |
| CLogS | -4.521 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 237.23 |
| Relative PSA | 0.49635 |
| PolarSurfaceArea | 152.22 |
| Druglikeness | 1.1977 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N-[(E)-(2,4-dichloro-5-nitrophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide | 2 - 4-amino-N-[(E)-(2,4-dichloro-5-nitrophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboxamide