| MolName | 1-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-3-phenylthiourea |
| MolecularFormula | C20H22N4O3S |
| Smiles | O=C(COc1ccc(/C=N\NC(Nc2ccccc2)=S)cc1)N1CCOCC1 |
| InChI | InChI=1S/C20H22N4O3S/c25-19(24-10-12-26-13-11-24)15-27-18-8-6-16(7-9-18)14-21-23-20(28)22-17-4-2-1-3-5-17/h1-9,14H,10-13,15H2,(H2,22,23,28) |
| InChIK | VIEVXVJRPWNADJ-UHFFFAOYSA-N |
| TotalMolweight | 398.486 |
| Molweight | 398.486 |
| MonoisotopicMass | 398.141261 |
| CLogP | 2.8414 |
| CLogS | -3.811 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 316.76 |
| Relative PSA | 0.3126 |
| PolarSurfaceArea | 107.28 |
| Druglikeness | 4.8769 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-3-phenylthiourea | 2 - 1-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-3-phenylthiourea