| MolName | 8-chloro-3-[(Z)-[(Z)-2-methyl-3-phenylprop-2-enylidene]amino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
| MolecularFormula | C20H15N4O2Cl |
| Smiles | C/C(/C=N\N(C(c([nH]c(cc1)c2cc1Cl)c2N1)=O)C1=O)=C/c1ccccc1 |
| InChI | InChI=1S/C20H15ClN4O2/c1-12(9-13-5-3-2-4-6-13)11-22-25-19(26)18-17(24-20(25)27)15-10-14(21)7-8-16(15)23-18/h2-11,23H,1H3,(H,24,27) |
| InChIK | VQCFIVQULHZAKB-UHFFFAOYSA-N |
| TotalMolweight | 378.818 |
| Molweight | 378.818 |
| MonoisotopicMass | 378.088353 |
| CLogP | 3.7471 |
| CLogS | -5.799 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 278.1 |
| Relative PSA | 0.23945 |
| PolarSurfaceArea | 77.56 |
| Druglikeness | 5.1753 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.59259 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 8-chloro-3-[(Z)-[(Z)-2-methyl-3-phenylprop-2-enylidene]amino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione | 2 - 8-chloro-3-[(Z)-[(Z)-2-methyl-3-phenylprop-2-enylidene]amino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione