| MolName | N,N'-bis[(Z)-(5-nitrofuran-2-yl)methylideneamino]octanediamide |
| MolecularFormula | C18H20N6O8 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(CCCCCCC(N/N=C\c2ccc([N+]([O-])=O)o2)=O)=O)o1)=O |
| InChI | InChI=1S/C18H20N6O8/c25-15(21-19-11-13-7-9-17(31-13)23(27)28)5-3-1-2-4-6-16(26)22-20-12-14-8-10-18(32-14)24(29)30/h7-12H,1-6H2,(H,21,25)(H,22,26) |
| InChIK | WNXMVSGYQSXPCQ-UHFFFAOYSA-N |
| TotalMolweight | 448.391 |
| Molweight | 448.391 |
| MonoisotopicMass | 448.134264 |
| CLogP | 2.5018 |
| CLogS | -7.072 |
| H Acceptors | 14 |
| H Donors | 2 |
| TotalSurfaceArea | 350.24 |
| Relative PSA | 0.45991 |
| PolarSurfaceArea | 200.84 |
| Druglikeness | -5.3919 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 13 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 8 |
| Symmetricatoms | 16 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-(5-nitrofuran-2-yl)methylideneamino]octanediamide | 2 - N,N'-bis[(Z)-(5-nitrofuran-2-yl)methylideneamino]octanediamide