| MolName | (Z)-1-(5-bromothiophen-2-yl)-N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]methanimine |
| MolecularFormula | C10H6N2Br2S2 |
| Smiles | Brc1ccc(/C=N\N=C/c(s2)ccc2Br)s1 |
| InChI | InChI=1S/C10H6Br2N2S2/c11-9-3-1-7(15-9)5-13-14-6-8-2-4-10(12)16-8/h1-6H |
| InChIK | XVTZWVIVQKIQPU-UHFFFAOYSA-N |
| TotalMolweight | 378.112 |
| Molweight | 378.112 |
| MonoisotopicMass | 375.83391 |
| CLogP | 6.3786 |
| CLogS | -5.854 |
| H Acceptors | 2 |
| TotalSurfaceArea | 211.68 |
| Relative PSA | 0.30111 |
| PolarSurfaceArea | 81.2 |
| Druglikeness | -0.20844 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(5-bromothiophen-2-yl)-N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]methanimine | 2 - (Z)-1-(5-bromothiophen-2-yl)-N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]methanimine